About 4-amino-1-propyl-1,3-diazaspiro[4.4]non-3-en-2-one
4-amino-1-propyl-1,3-diazaspiro[4.4]non-3-en-2-one (PubChem CID 79961769) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is 4-amino-1-propyl-1,3-diazaspiro[4.4]non-3-en-2-one.
Molecular Properties
| Compound Name | 4-amino-1-propyl-1,3-diazaspiro[4.4]non-3-en-2-one |
| PubChem CID | 79961769 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 4-amino-1-propyl-1,3-diazaspiro[4.4]non-3-en-2-one |
| SMILES | CCCN1C(=O)N=C(N)C12CCCC2 |
| InChI | InChI=1S/C10H17N3O/c1-2-7-13-9(14)12-8(11)10(13)5-3-4-6-10/h2-7H2,1H3,(H2,11,12,14) |
| InChIKey | DCDKGDZJQSJCTQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-1-propyl-1,3-diazaspiro[4.4]non-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-propyl-1,3-diazaspiro[4.4]non-3-en-2-one?
The IUPAC name of 4-amino-1-propyl-1,3-diazaspiro[4.4]non-3-en-2-one (CID 79961769) is 4-amino-1-propyl-1,3-diazaspiro[4.4]non-3-en-2-one.
What is the SMILES notation for 4-amino-1-propyl-1,3-diazaspiro[4.4]non-3-en-2-one?
The canonical SMILES for 4-amino-1-propyl-1,3-diazaspiro[4.4]non-3-en-2-one is CCCN1C(=O)N=C(N)C12CCCC2.
What is the InChIKey of 4-amino-1-propyl-1,3-diazaspiro[4.4]non-3-en-2-one?
The InChIKey is DCDKGDZJQSJCTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O/c1-2-7-13-9(14)12-8(11)10(13)5-3-4-6-10/h2-7H2,1H3,(H2,11,12,14).
What are the key properties of 4-amino-1-propyl-1,3-diazaspiro[4.4]non-3-en-2-one?
4-amino-1-propyl-1,3-diazaspiro[4.4]non-3-en-2-one has a molecular weight of 195.27 g/mol, XLogP of 1.50, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-propyl-1,3-diazaspiro[4.4]non-3-en-2-one is sourced from PubChem (CID 79961769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).