C12H21N3O — CID 79961824
4-amino-1,8-diethyl-1,3-diazaspiro[4.5]dec-3-en-2-one (PubChem CID 79961824) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 4-amino-1,8-diethyl-1,3-diazaspiro[4.5]dec-3-en-2-one.
| Compound Name | 4-amino-1,8-diethyl-1,3-diazaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 79961824 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 4-amino-1,8-diethyl-1,3-diazaspiro[4.5]dec-3-en-2-one |
| SMILES | CCC1CCC2(CC1)C(N)=NC(=O)N2CC |
| InChI | InChI=1S/C12H21N3O/c1-3-9-5-7-12(8-6-9)10(13)14-11(16)15(12)4-2/h9H,3-8H2,1-2H3,(H2,13,14,16) |
| InChIKey | QMXVTEFPNOTFHW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |