C14H19N3O3 — CID 79962136
5-amino-4-(3-ethoxy-4-hydroxyphenyl)-3-propyl-4H-imidazol-2-one (PubChem CID 79962136) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 5-amino-4-(3-ethoxy-4-hydroxyphenyl)-3-propyl-4H-imidazol-2-one.
| Compound Name | 5-amino-4-(3-ethoxy-4-hydroxyphenyl)-3-propyl-4H-imidazol-2-one |
|---|---|
| PubChem CID | 79962136 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 5-amino-4-(3-ethoxy-4-hydroxyphenyl)-3-propyl-4H-imidazol-2-one |
| SMILES | CCCN1C(=O)N=C(N)C1c1ccc(O)c(OCC)c1 |
| InChI | InChI=1S/C14H19N3O3/c1-3-7-17-12(13(15)16-14(17)19)9-5-6-10(18)11(8-9)20-4-2/h5-6,8,12,18H,3-4,7H2,1-2H3,(H2,15,16,19) |
| InChIKey | SAQQOLOZMQIJHE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |