C12H14F3NOS — CID 79962415
1,4-oxathian-2-yl-[4-(trifluoromethyl)phenyl]methanamine (PubChem CID 79962415) has the molecular formula C12H14F3NOS and a molecular weight of 277.31 g/mol. Its IUPAC name is 1,4-oxathian-2-yl-[4-(trifluoromethyl)phenyl]methanamine.
| Compound Name | 1,4-oxathian-2-yl-[4-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 79962415 |
| Molecular Formula | C12H14F3NOS |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 1,4-oxathian-2-yl-[4-(trifluoromethyl)phenyl]methanamine |
| SMILES | NC(c1ccc(C(F)(F)F)cc1)C1CSCCO1 |
| InChI | InChI=1S/C12H14F3NOS/c13-12(14,15)9-3-1-8(2-4-9)11(16)10-7-18-6-5-17-10/h1-4,10-11H,5-7,16H2 |
| InChIKey | OAOPULKKCKLZIH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |