About N-methyl-1-(1,4-oxathian-2-yl)pent-3-yn-1-amine
N-methyl-1-(1,4-oxathian-2-yl)pent-3-yn-1-amine (PubChem CID 79962432) has the molecular formula C10H17NOS
and a molecular weight of 199.32 g/mol. Its IUPAC name is N-methyl-1-(1,4-oxathian-2-yl)pent-3-yn-1-amine.
Molecular Properties
| Compound Name | N-methyl-1-(1,4-oxathian-2-yl)pent-3-yn-1-amine |
| PubChem CID | 79962432 |
| Molecular Formula | C10H17NOS |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | N-methyl-1-(1,4-oxathian-2-yl)pent-3-yn-1-amine |
| SMILES | CC#CCC(NC)C1CSCCO1 |
| InChI | InChI=1S/C10H17NOS/c1-3-4-5-9(11-2)10-8-13-7-6-12-10/h9-11H,5-8H2,1-2H3 |
| InChIKey | HJGGWNPSLHRLDA-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1-(1,4-oxathian-2-yl)pent-3-yn-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(1,4-oxathian-2-yl)pent-3-yn-1-amine?
The IUPAC name of N-methyl-1-(1,4-oxathian-2-yl)pent-3-yn-1-amine (CID 79962432) is N-methyl-1-(1,4-oxathian-2-yl)pent-3-yn-1-amine.
What is the SMILES notation for N-methyl-1-(1,4-oxathian-2-yl)pent-3-yn-1-amine?
The canonical SMILES for N-methyl-1-(1,4-oxathian-2-yl)pent-3-yn-1-amine is CC#CCC(NC)C1CSCCO1.
What is the InChIKey of N-methyl-1-(1,4-oxathian-2-yl)pent-3-yn-1-amine?
The InChIKey is HJGGWNPSLHRLDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NOS/c1-3-4-5-9(11-2)10-8-13-7-6-12-10/h9-11H,5-8H2,1-2H3.
What are the key properties of N-methyl-1-(1,4-oxathian-2-yl)pent-3-yn-1-amine?
N-methyl-1-(1,4-oxathian-2-yl)pent-3-yn-1-amine has a molecular weight of 199.32 g/mol, XLogP of 1.12, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(1,4-oxathian-2-yl)pent-3-yn-1-amine is sourced from PubChem (CID 79962432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).