About 2-ethoxy-1-(1,4-oxathian-2-yl)ethanamine
2-ethoxy-1-(1,4-oxathian-2-yl)ethanamine (PubChem CID 79962716) has the molecular formula C8H17NO2S
and a molecular weight of 191.30 g/mol. Its IUPAC name is 2-ethoxy-1-(1,4-oxathian-2-yl)ethanamine.
Molecular Properties
| Compound Name | 2-ethoxy-1-(1,4-oxathian-2-yl)ethanamine |
| PubChem CID | 79962716 |
| Molecular Formula | C8H17NO2S |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | 2-ethoxy-1-(1,4-oxathian-2-yl)ethanamine |
| SMILES | CCOCC(N)C1CSCCO1 |
| InChI | InChI=1S/C8H17NO2S/c1-2-10-5-7(9)8-6-12-4-3-11-8/h7-8H,2-6,9H2,1H3 |
| InChIKey | QGRXQEPGNWRDHW-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethoxy-1-(1,4-oxathian-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-1-(1,4-oxathian-2-yl)ethanamine?
The IUPAC name of 2-ethoxy-1-(1,4-oxathian-2-yl)ethanamine (CID 79962716) is 2-ethoxy-1-(1,4-oxathian-2-yl)ethanamine.
What is the SMILES notation for 2-ethoxy-1-(1,4-oxathian-2-yl)ethanamine?
The canonical SMILES for 2-ethoxy-1-(1,4-oxathian-2-yl)ethanamine is CCOCC(N)C1CSCCO1.
What is the InChIKey of 2-ethoxy-1-(1,4-oxathian-2-yl)ethanamine?
The InChIKey is QGRXQEPGNWRDHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2S/c1-2-10-5-7(9)8-6-12-4-3-11-8/h7-8H,2-6,9H2,1H3.
What are the key properties of 2-ethoxy-1-(1,4-oxathian-2-yl)ethanamine?
2-ethoxy-1-(1,4-oxathian-2-yl)ethanamine has a molecular weight of 191.30 g/mol, XLogP of 0.48, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-1-(1,4-oxathian-2-yl)ethanamine is sourced from PubChem (CID 79962716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).