About 1-(1,4-oxathian-2-yl)-2-propoxyethanamine
1-(1,4-oxathian-2-yl)-2-propoxyethanamine (PubChem CID 79962816) has the molecular formula C9H19NO2S
and a molecular weight of 205.32 g/mol. Its IUPAC name is 1-(1,4-oxathian-2-yl)-2-propoxyethanamine.
Molecular Properties
| Compound Name | 1-(1,4-oxathian-2-yl)-2-propoxyethanamine |
| PubChem CID | 79962816 |
| Molecular Formula | C9H19NO2S |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 1-(1,4-oxathian-2-yl)-2-propoxyethanamine |
| SMILES | CCCOCC(N)C1CSCCO1 |
| InChI | InChI=1S/C9H19NO2S/c1-2-3-11-6-8(10)9-7-13-5-4-12-9/h8-9H,2-7,10H2,1H3 |
| InChIKey | GBQHSUDFDBWEOT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,4-oxathian-2-yl)-2-propoxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,4-oxathian-2-yl)-2-propoxyethanamine?
The IUPAC name of 1-(1,4-oxathian-2-yl)-2-propoxyethanamine (CID 79962816) is 1-(1,4-oxathian-2-yl)-2-propoxyethanamine.
What is the SMILES notation for 1-(1,4-oxathian-2-yl)-2-propoxyethanamine?
The canonical SMILES for 1-(1,4-oxathian-2-yl)-2-propoxyethanamine is CCCOCC(N)C1CSCCO1.
What is the InChIKey of 1-(1,4-oxathian-2-yl)-2-propoxyethanamine?
The InChIKey is GBQHSUDFDBWEOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2S/c1-2-3-11-6-8(10)9-7-13-5-4-12-9/h8-9H,2-7,10H2,1H3.
What are the key properties of 1-(1,4-oxathian-2-yl)-2-propoxyethanamine?
1-(1,4-oxathian-2-yl)-2-propoxyethanamine has a molecular weight of 205.32 g/mol, XLogP of 0.87, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4-oxathian-2-yl)-2-propoxyethanamine is sourced from PubChem (CID 79962816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).