About (4-bromothiophen-3-yl)-(1,4-oxathian-2-yl)methanol
(4-bromothiophen-3-yl)-(1,4-oxathian-2-yl)methanol (PubChem CID 79962907) has the molecular formula C9H11BrO2S2
and a molecular weight of 295.22 g/mol. Its IUPAC name is (4-bromothiophen-3-yl)-(1,4-oxathian-2-yl)methanol.
Molecular Properties
| Compound Name | (4-bromothiophen-3-yl)-(1,4-oxathian-2-yl)methanol |
| PubChem CID | 79962907 |
| Molecular Formula | C9H11BrO2S2 |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 293.94 |
| IUPAC Name | (4-bromothiophen-3-yl)-(1,4-oxathian-2-yl)methanol |
| SMILES | OC(c1cscc1Br)C1CSCCO1 |
| InChI | InChI=1S/C9H11BrO2S2/c10-7-4-14-3-6(7)9(11)8-5-13-2-1-12-8/h3-4,8-9,11H,1-2,5H2 |
| InChIKey | QZVIWLHOAFXHJF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-bromothiophen-3-yl)-(1,4-oxathian-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromothiophen-3-yl)-(1,4-oxathian-2-yl)methanol?
The IUPAC name of (4-bromothiophen-3-yl)-(1,4-oxathian-2-yl)methanol (CID 79962907) is (4-bromothiophen-3-yl)-(1,4-oxathian-2-yl)methanol.
What is the SMILES notation for (4-bromothiophen-3-yl)-(1,4-oxathian-2-yl)methanol?
The canonical SMILES for (4-bromothiophen-3-yl)-(1,4-oxathian-2-yl)methanol is OC(c1cscc1Br)C1CSCCO1.
What is the InChIKey of (4-bromothiophen-3-yl)-(1,4-oxathian-2-yl)methanol?
The InChIKey is QZVIWLHOAFXHJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrO2S2/c10-7-4-14-3-6(7)9(11)8-5-13-2-1-12-8/h3-4,8-9,11H,1-2,5H2.
What are the key properties of (4-bromothiophen-3-yl)-(1,4-oxathian-2-yl)methanol?
(4-bromothiophen-3-yl)-(1,4-oxathian-2-yl)methanol has a molecular weight of 295.22 g/mol, XLogP of 2.68, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromothiophen-3-yl)-(1,4-oxathian-2-yl)methanol is sourced from PubChem (CID 79962907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).