About 3-[methylamino(1,4-oxathian-2-yl)methyl]pyridin-2-amine
3-[methylamino(1,4-oxathian-2-yl)methyl]pyridin-2-amine (PubChem CID 79962941) has the molecular formula C11H17N3OS
and a molecular weight of 239.34 g/mol. Its IUPAC name is 3-[methylamino(1,4-oxathian-2-yl)methyl]pyridin-2-amine.
Molecular Properties
| Compound Name | 3-[methylamino(1,4-oxathian-2-yl)methyl]pyridin-2-amine |
| PubChem CID | 79962941 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 3-[methylamino(1,4-oxathian-2-yl)methyl]pyridin-2-amine |
| SMILES | CNC(c1cccnc1N)C1CSCCO1 |
| InChI | InChI=1S/C11H17N3OS/c1-13-10(9-7-16-6-5-15-9)8-3-2-4-14-11(8)12/h2-4,9-10,13H,5-7H2,1H3,(H2,12,14) |
| InChIKey | JILAPWUIAFLBIY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[methylamino(1,4-oxathian-2-yl)methyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[methylamino(1,4-oxathian-2-yl)methyl]pyridin-2-amine?
The IUPAC name of 3-[methylamino(1,4-oxathian-2-yl)methyl]pyridin-2-amine (CID 79962941) is 3-[methylamino(1,4-oxathian-2-yl)methyl]pyridin-2-amine.
What is the SMILES notation for 3-[methylamino(1,4-oxathian-2-yl)methyl]pyridin-2-amine?
The canonical SMILES for 3-[methylamino(1,4-oxathian-2-yl)methyl]pyridin-2-amine is CNC(c1cccnc1N)C1CSCCO1.
What is the InChIKey of 3-[methylamino(1,4-oxathian-2-yl)methyl]pyridin-2-amine?
The InChIKey is JILAPWUIAFLBIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3OS/c1-13-10(9-7-16-6-5-15-9)8-3-2-4-14-11(8)12/h2-4,9-10,13H,5-7H2,1H3,(H2,12,14).
What are the key properties of 3-[methylamino(1,4-oxathian-2-yl)methyl]pyridin-2-amine?
3-[methylamino(1,4-oxathian-2-yl)methyl]pyridin-2-amine has a molecular weight of 239.34 g/mol, XLogP of 1.06, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[methylamino(1,4-oxathian-2-yl)methyl]pyridin-2-amine is sourced from PubChem (CID 79962941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).