About 2-methyl-1-(1,4-oxathian-2-yl)propan-1-amine
2-methyl-1-(1,4-oxathian-2-yl)propan-1-amine (PubChem CID 79963119) has the molecular formula C8H17NOS
and a molecular weight of 175.30 g/mol. Its IUPAC name is 2-methyl-1-(1,4-oxathian-2-yl)propan-1-amine.
Molecular Properties
| Compound Name | 2-methyl-1-(1,4-oxathian-2-yl)propan-1-amine |
| PubChem CID | 79963119 |
| Molecular Formula | C8H17NOS |
| Molecular Weight | 175.30 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 2-methyl-1-(1,4-oxathian-2-yl)propan-1-amine |
| SMILES | CC(C)C(N)C1CSCCO1 |
| InChI | InChI=1S/C8H17NOS/c1-6(2)8(9)7-5-11-4-3-10-7/h6-8H,3-5,9H2,1-2H3 |
| InChIKey | SGSNCRRVYJVSOI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-1-(1,4-oxathian-2-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-(1,4-oxathian-2-yl)propan-1-amine?
The IUPAC name of 2-methyl-1-(1,4-oxathian-2-yl)propan-1-amine (CID 79963119) is 2-methyl-1-(1,4-oxathian-2-yl)propan-1-amine.
What is the SMILES notation for 2-methyl-1-(1,4-oxathian-2-yl)propan-1-amine?
The canonical SMILES for 2-methyl-1-(1,4-oxathian-2-yl)propan-1-amine is CC(C)C(N)C1CSCCO1.
What is the InChIKey of 2-methyl-1-(1,4-oxathian-2-yl)propan-1-amine?
The InChIKey is SGSNCRRVYJVSOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NOS/c1-6(2)8(9)7-5-11-4-3-10-7/h6-8H,3-5,9H2,1-2H3.
What are the key properties of 2-methyl-1-(1,4-oxathian-2-yl)propan-1-amine?
2-methyl-1-(1,4-oxathian-2-yl)propan-1-amine has a molecular weight of 175.30 g/mol, XLogP of 1.10, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-(1,4-oxathian-2-yl)propan-1-amine is sourced from PubChem (CID 79963119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).