About naphthalen-2-yl(1,4-oxathian-2-yl)methanol
naphthalen-2-yl(1,4-oxathian-2-yl)methanol (PubChem CID 79963790) has the molecular formula C15H16O2S
and a molecular weight of 260.36 g/mol. Its IUPAC name is naphthalen-2-yl(1,4-oxathian-2-yl)methanol.
Molecular Properties
| Compound Name | naphthalen-2-yl(1,4-oxathian-2-yl)methanol |
| PubChem CID | 79963790 |
| Molecular Formula | C15H16O2S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | naphthalen-2-yl(1,4-oxathian-2-yl)methanol |
| SMILES | OC(c1ccc2ccccc2c1)C1CSCCO1 |
| InChI | InChI=1S/C15H16O2S/c16-15(14-10-18-8-7-17-14)13-6-5-11-3-1-2-4-12(11)9-13/h1-6,9,14-16H,7-8,10H2 |
| InChIKey | KSTVDFUSOOYELQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze naphthalen-2-yl(1,4-oxathian-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-2-yl(1,4-oxathian-2-yl)methanol?
The IUPAC name of naphthalen-2-yl(1,4-oxathian-2-yl)methanol (CID 79963790) is naphthalen-2-yl(1,4-oxathian-2-yl)methanol.
What is the SMILES notation for naphthalen-2-yl(1,4-oxathian-2-yl)methanol?
The canonical SMILES for naphthalen-2-yl(1,4-oxathian-2-yl)methanol is OC(c1ccc2ccccc2c1)C1CSCCO1.
What is the InChIKey of naphthalen-2-yl(1,4-oxathian-2-yl)methanol?
The InChIKey is KSTVDFUSOOYELQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O2S/c16-15(14-10-18-8-7-17-14)13-6-5-11-3-1-2-4-12(11)9-13/h1-6,9,14-16H,7-8,10H2.
What are the key properties of naphthalen-2-yl(1,4-oxathian-2-yl)methanol?
naphthalen-2-yl(1,4-oxathian-2-yl)methanol has a molecular weight of 260.36 g/mol, XLogP of 3.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-2-yl(1,4-oxathian-2-yl)methanol is sourced from PubChem (CID 79963790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).