About N,2-dimethyl-1-(1,4-oxathian-2-yl)butan-1-amine
N,2-dimethyl-1-(1,4-oxathian-2-yl)butan-1-amine (PubChem CID 79963836) has the molecular formula C10H21NOS
and a molecular weight of 203.35 g/mol. Its IUPAC name is N,2-dimethyl-1-(1,4-oxathian-2-yl)butan-1-amine.
Molecular Properties
| Compound Name | N,2-dimethyl-1-(1,4-oxathian-2-yl)butan-1-amine |
| PubChem CID | 79963836 |
| Molecular Formula | C10H21NOS |
| Molecular Weight | 203.35 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | N,2-dimethyl-1-(1,4-oxathian-2-yl)butan-1-amine |
| SMILES | CCC(C)C(NC)C1CSCCO1 |
| InChI | InChI=1S/C10H21NOS/c1-4-8(2)10(11-3)9-7-13-6-5-12-9/h8-11H,4-7H2,1-3H3 |
| InChIKey | CQGGLNCWNZTXQA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,2-dimethyl-1-(1,4-oxathian-2-yl)butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethyl-1-(1,4-oxathian-2-yl)butan-1-amine?
The IUPAC name of N,2-dimethyl-1-(1,4-oxathian-2-yl)butan-1-amine (CID 79963836) is N,2-dimethyl-1-(1,4-oxathian-2-yl)butan-1-amine.
What is the SMILES notation for N,2-dimethyl-1-(1,4-oxathian-2-yl)butan-1-amine?
The canonical SMILES for N,2-dimethyl-1-(1,4-oxathian-2-yl)butan-1-amine is CCC(C)C(NC)C1CSCCO1.
What is the InChIKey of N,2-dimethyl-1-(1,4-oxathian-2-yl)butan-1-amine?
The InChIKey is CQGGLNCWNZTXQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NOS/c1-4-8(2)10(11-3)9-7-13-6-5-12-9/h8-11H,4-7H2,1-3H3.
What are the key properties of N,2-dimethyl-1-(1,4-oxathian-2-yl)butan-1-amine?
N,2-dimethyl-1-(1,4-oxathian-2-yl)butan-1-amine has a molecular weight of 203.35 g/mol, XLogP of 1.75, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethyl-1-(1,4-oxathian-2-yl)butan-1-amine is sourced from PubChem (CID 79963836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).