C10H11F3N4S — CID 79964166
[6-methyl-2-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 79964166) has the molecular formula C10H11F3N4S and a molecular weight of 276.29 g/mol. Its IUPAC name is [6-methyl-2-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [6-methyl-2-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 79964166 |
| Molecular Formula | C10H11F3N4S |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | [6-methyl-2-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | Cc1cc2c(NN)nc(CCC(F)(F)F)nc2s1 |
| InChI | InChI=1S/C10H11F3N4S/c1-5-4-6-8(17-14)15-7(16-9(6)18-5)2-3-10(11,12)13/h4H,2-3,14H2,1H3,(H,15,16,17) |
| InChIKey | JOIXKPARDGICNO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|