C10H13F3N4 — CID 79964167
[2-(3,3,3-trifluoropropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine (PubChem CID 79964167) has the molecular formula C10H13F3N4 and a molecular weight of 246.24 g/mol. Its IUPAC name is [2-(3,3,3-trifluoropropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(3,3,3-trifluoropropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 79964167 |
| Molecular Formula | C10H13F3N4 |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | [2-(3,3,3-trifluoropropyl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1nc(CCC(F)(F)F)nc2c1CCC2 |
| InChI | InChI=1S/C10H13F3N4/c11-10(12,13)5-4-8-15-7-3-1-2-6(7)9(16-8)17-14/h1-5,14H2,(H,15,16,17) |
| InChIKey | KGCFDUMFYLLHGF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|