C9H11F3N2S — CID 79964343
2-(3,3,3-trifluoropropyl)-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine (PubChem CID 79964343) has the molecular formula C9H11F3N2S and a molecular weight of 236.26 g/mol. Its IUPAC name is 2-(3,3,3-trifluoropropyl)-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine.
| Compound Name | 2-(3,3,3-trifluoropropyl)-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 79964343 |
| Molecular Formula | C9H11F3N2S |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 2-(3,3,3-trifluoropropyl)-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine |
| SMILES | FC(F)(F)CCc1nc2c(s1)CNCC2 |
| InChI | InChI=1S/C9H11F3N2S/c10-9(11,12)3-1-8-14-6-2-4-13-5-7(6)15-8/h13H,1-5H2 |
| InChIKey | MVFJFABMRNSSGV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |