About 2-[[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]methyl]-1,3-benzoxazol-5-amine
2-[[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]methyl]-1,3-benzoxazol-5-amine (PubChem CID 79964561) has the molecular formula C14H16N4O2
and a molecular weight of 272.31 g/mol. Its IUPAC name is 2-[[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]methyl]-1,3-benzoxazol-5-amine.
Molecular Properties
| Compound Name | 2-[[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]methyl]-1,3-benzoxazol-5-amine |
| PubChem CID | 79964561 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2-[[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]methyl]-1,3-benzoxazol-5-amine |
| SMILES | Cc1cc(CN(C)Cc2nc3cc(N)ccc3o2)no1 |
| InChI | InChI=1S/C14H16N4O2/c1-9-5-11(17-20-9)7-18(2)8-14-16-12-6-10(15)3-4-13(12)19-14/h3-6H,7-8,15H2,1-2H3 |
| InChIKey | GCTWEXKGCSXSPX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]methyl]-1,3-benzoxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]methyl]-1,3-benzoxazol-5-amine?
The IUPAC name of 2-[[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]methyl]-1,3-benzoxazol-5-amine (CID 79964561) is 2-[[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]methyl]-1,3-benzoxazol-5-amine.
What is the SMILES notation for 2-[[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]methyl]-1,3-benzoxazol-5-amine?
The canonical SMILES for 2-[[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]methyl]-1,3-benzoxazol-5-amine is Cc1cc(CN(C)Cc2nc3cc(N)ccc3o2)no1.
What is the InChIKey of 2-[[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]methyl]-1,3-benzoxazol-5-amine?
The InChIKey is GCTWEXKGCSXSPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O2/c1-9-5-11(17-20-9)7-18(2)8-14-16-12-6-10(15)3-4-13(12)19-14/h3-6H,7-8,15H2,1-2H3.
What are the key properties of 2-[[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]methyl]-1,3-benzoxazol-5-amine?
2-[[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]methyl]-1,3-benzoxazol-5-amine has a molecular weight of 272.31 g/mol, XLogP of 2.34, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[methyl-[(5-methyl-1,2-oxazol-3-yl)methyl]amino]methyl]-1,3-benzoxazol-5-amine is sourced from PubChem (CID 79964561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).