C9H13F3N4 — CID 79964597
[5,6-dimethyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-yl]hydrazine (PubChem CID 79964597) has the molecular formula C9H13F3N4 and a molecular weight of 234.22 g/mol. Its IUPAC name is [5,6-dimethyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-yl]hydrazine.
| Compound Name | [5,6-dimethyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 79964597 |
| Molecular Formula | C9H13F3N4 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | [5,6-dimethyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(CCC(F)(F)F)nc(NN)c1C |
| InChI | InChI=1S/C9H13F3N4/c1-5-6(2)14-7(15-8(5)16-13)3-4-9(10,11)12/h3-4,13H2,1-2H3,(H,14,15,16) |
| InChIKey | WAXHPRFUBCCNRC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|