About N-methyl-1-[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methanamine
N-methyl-1-[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methanamine (PubChem CID 79964687) has the molecular formula C8H12F3N3
and a molecular weight of 207.20 g/mol. Its IUPAC name is N-methyl-1-[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methanamine.
Molecular Properties
| Compound Name | N-methyl-1-[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methanamine |
| PubChem CID | 79964687 |
| Molecular Formula | C8H12F3N3 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | N-methyl-1-[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methanamine |
| SMILES | CNCc1cnc(CCC(F)(F)F)[nH]1 |
| InChI | InChI=1S/C8H12F3N3/c1-12-4-6-5-13-7(14-6)2-3-8(9,10)11/h5,12H,2-4H2,1H3,(H,13,14) |
| InChIKey | ZSPOEOBFVXJFHR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-1-[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methanamine?
The IUPAC name of N-methyl-1-[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methanamine (CID 79964687) is N-methyl-1-[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methanamine.
What is the SMILES notation for N-methyl-1-[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methanamine?
The canonical SMILES for N-methyl-1-[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methanamine is CNCc1cnc(CCC(F)(F)F)[nH]1.
What is the InChIKey of N-methyl-1-[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methanamine?
The InChIKey is ZSPOEOBFVXJFHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F3N3/c1-12-4-6-5-13-7(14-6)2-3-8(9,10)11/h5,12H,2-4H2,1H3,(H,13,14).
What are the key properties of N-methyl-1-[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methanamine?
N-methyl-1-[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methanamine has a molecular weight of 207.20 g/mol, XLogP of 1.62, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methanamine is sourced from PubChem (CID 79964687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).