About 2-methoxy-N-[[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methyl]ethanamine
2-methoxy-N-[[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methyl]ethanamine (PubChem CID 79964947) has the molecular formula C10H16F3N3O
and a molecular weight of 251.25 g/mol. Its IUPAC name is 2-methoxy-N-[[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methyl]ethanamine.
Molecular Properties
| Compound Name | 2-methoxy-N-[[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methyl]ethanamine |
| PubChem CID | 79964947 |
| Molecular Formula | C10H16F3N3O |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 2-methoxy-N-[[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methyl]ethanamine |
| SMILES | COCCNCc1cnc(CCC(F)(F)F)[nH]1 |
| InChI | InChI=1S/C10H16F3N3O/c1-17-5-4-14-6-8-7-15-9(16-8)2-3-10(11,12)13/h7,14H,2-6H2,1H3,(H,15,16) |
| InChIKey | NSORWQXKCKGFEE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-N-[[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N-[[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methyl]ethanamine?
The IUPAC name of 2-methoxy-N-[[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methyl]ethanamine (CID 79964947) is 2-methoxy-N-[[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methyl]ethanamine.
What is the SMILES notation for 2-methoxy-N-[[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methyl]ethanamine?
The canonical SMILES for 2-methoxy-N-[[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methyl]ethanamine is COCCNCc1cnc(CCC(F)(F)F)[nH]1.
What is the InChIKey of 2-methoxy-N-[[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methyl]ethanamine?
The InChIKey is NSORWQXKCKGFEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F3N3O/c1-17-5-4-14-6-8-7-15-9(16-8)2-3-10(11,12)13/h7,14H,2-6H2,1H3,(H,15,16).
What are the key properties of 2-methoxy-N-[[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methyl]ethanamine?
2-methoxy-N-[[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methyl]ethanamine has a molecular weight of 251.25 g/mol, XLogP of 1.64, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N-[[2-(3,3,3-trifluoropropyl)-1H-imidazol-5-yl]methyl]ethanamine is sourced from PubChem (CID 79964947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).