About 2-[4-[(5-amino-1,3-benzoxazol-2-yl)methyl]piperazin-1-yl]ethanol
2-[4-[(5-amino-1,3-benzoxazol-2-yl)methyl]piperazin-1-yl]ethanol (PubChem CID 79964992) has the molecular formula C14H20N4O2
and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-[4-[(5-amino-1,3-benzoxazol-2-yl)methyl]piperazin-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-[(5-amino-1,3-benzoxazol-2-yl)methyl]piperazin-1-yl]ethanol |
| PubChem CID | 79964992 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 2-[4-[(5-amino-1,3-benzoxazol-2-yl)methyl]piperazin-1-yl]ethanol |
| SMILES | Nc1ccc2oc(CN3CCN(CCO)CC3)nc2c1 |
| InChI | InChI=1S/C14H20N4O2/c15-11-1-2-13-12(9-11)16-14(20-13)10-18-5-3-17(4-6-18)7-8-19/h1-2,9,19H,3-8,10,15H2 |
| InChIKey | ONCJAXTYMPEVOY-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(5-amino-1,3-benzoxazol-2-yl)methyl]piperazin-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(5-amino-1,3-benzoxazol-2-yl)methyl]piperazin-1-yl]ethanol?
The IUPAC name of 2-[4-[(5-amino-1,3-benzoxazol-2-yl)methyl]piperazin-1-yl]ethanol (CID 79964992) is 2-[4-[(5-amino-1,3-benzoxazol-2-yl)methyl]piperazin-1-yl]ethanol.
What is the SMILES notation for 2-[4-[(5-amino-1,3-benzoxazol-2-yl)methyl]piperazin-1-yl]ethanol?
The canonical SMILES for 2-[4-[(5-amino-1,3-benzoxazol-2-yl)methyl]piperazin-1-yl]ethanol is Nc1ccc2oc(CN3CCN(CCO)CC3)nc2c1.
What is the InChIKey of 2-[4-[(5-amino-1,3-benzoxazol-2-yl)methyl]piperazin-1-yl]ethanol?
The InChIKey is ONCJAXTYMPEVOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4O2/c15-11-1-2-13-12(9-11)16-14(20-13)10-18-5-3-17(4-6-18)7-8-19/h1-2,9,19H,3-8,10,15H2.
What are the key properties of 2-[4-[(5-amino-1,3-benzoxazol-2-yl)methyl]piperazin-1-yl]ethanol?
2-[4-[(5-amino-1,3-benzoxazol-2-yl)methyl]piperazin-1-yl]ethanol has a molecular weight of 276.34 g/mol, XLogP of 0.52, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(5-amino-1,3-benzoxazol-2-yl)methyl]piperazin-1-yl]ethanol is sourced from PubChem (CID 79964992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).