About ethyl 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-5-carboxylate
ethyl 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-5-carboxylate (PubChem CID 79965019) has the molecular formula C10H11F3N2O3
and a molecular weight of 264.20 g/mol. Its IUPAC name is ethyl 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-5-carboxylate |
| PubChem CID | 79965019 |
| Molecular Formula | C10H11F3N2O3 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | ethyl 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(CCC(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C10H11F3N2O3/c1-2-18-9(17)6-5-14-7(15-8(6)16)3-4-10(11,12)13/h5H,2-4H2,1H3,(H,14,15,16) |
| InChIKey | AQSZBINEFQMAIQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-5-carboxylate?
The IUPAC name of ethyl 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-5-carboxylate (CID 79965019) is ethyl 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-5-carboxylate.
What is the SMILES notation for ethyl 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-5-carboxylate?
The canonical SMILES for ethyl 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-5-carboxylate is CCOC(=O)c1cnc(CCC(F)(F)F)[nH]c1=O.
What is the InChIKey of ethyl 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-5-carboxylate?
The InChIKey is AQSZBINEFQMAIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3N2O3/c1-2-18-9(17)6-5-14-7(15-8(6)16)3-4-10(11,12)13/h5H,2-4H2,1H3,(H,14,15,16).
What are the key properties of ethyl 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-5-carboxylate?
ethyl 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-5-carboxylate has a molecular weight of 264.20 g/mol, XLogP of 1.44, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-oxo-2-(3,3,3-trifluoropropyl)-1H-pyrimidine-5-carboxylate is sourced from PubChem (CID 79965019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).