C10H15F3N2O3 — CID 79965038
5-(diethoxymethyl)-3-(3,3,3-trifluoropropyl)-1,2,4-oxadiazole (PubChem CID 79965038) has the molecular formula C10H15F3N2O3 and a molecular weight of 268.23 g/mol. Its IUPAC name is 5-(diethoxymethyl)-3-(3,3,3-trifluoropropyl)-1,2,4-oxadiazole.
| Compound Name | 5-(diethoxymethyl)-3-(3,3,3-trifluoropropyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 79965038 |
| Molecular Formula | C10H15F3N2O3 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 5-(diethoxymethyl)-3-(3,3,3-trifluoropropyl)-1,2,4-oxadiazole |
| SMILES | CCOC(OCC)c1nc(CCC(F)(F)F)no1 |
| InChI | InChI=1S/C10H15F3N2O3/c1-3-16-9(17-4-2)8-14-7(15-18-8)5-6-10(11,12)13/h9H,3-6H2,1-2H3 |
| InChIKey | GOBYCIFTVLQFEO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|