C9H12F3N3 — CID 79965193
5,6-dimethyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-amine (PubChem CID 79965193) has the molecular formula C9H12F3N3 and a molecular weight of 219.21 g/mol. Its IUPAC name is 5,6-dimethyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-amine.
| Compound Name | 5,6-dimethyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 79965193 |
| Molecular Formula | C9H12F3N3 |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 5,6-dimethyl-2-(3,3,3-trifluoropropyl)pyrimidin-4-amine |
| SMILES | Cc1nc(CCC(F)(F)F)nc(N)c1C |
| InChI | InChI=1S/C9H12F3N3/c1-5-6(2)14-7(15-8(5)13)3-4-9(10,11)12/h3-4H2,1-2H3,(H2,13,14,15) |
| InChIKey | NQBKYFLFBCYNCT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |