C9H9F3N4S — CID 79965201
[2-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 79965201) has the molecular formula C9H9F3N4S and a molecular weight of 262.26 g/mol. Its IUPAC name is [2-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 79965201 |
| Molecular Formula | C9H9F3N4S |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | [2-(3,3,3-trifluoropropyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1nc(CCC(F)(F)F)nc2sccc12 |
| InChI | InChI=1S/C9H9F3N4S/c10-9(11,12)3-1-6-14-7(16-13)5-2-4-17-8(5)15-6/h2,4H,1,3,13H2,(H,14,15,16) |
| InChIKey | CXJXUBNAWIIERZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|