C10H14N2O2S2 — CID 79965608
4-[3-(1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]butan-2-one (PubChem CID 79965608) has the molecular formula C10H14N2O2S2 and a molecular weight of 258.37 g/mol. Its IUPAC name is 4-[3-(1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]butan-2-one.
| Compound Name | 4-[3-(1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]butan-2-one |
|---|---|
| PubChem CID | 79965608 |
| Molecular Formula | C10H14N2O2S2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 4-[3-(1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]butan-2-one |
| SMILES | CC(=O)CCc1nc(C2CSCCS2)no1 |
| InChI | InChI=1S/C10H14N2O2S2/c1-7(13)2-3-9-11-10(12-14-9)8-6-15-4-5-16-8/h8H,2-6H2,1H3 |
| InChIKey | ULNCREARSRAMNC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |