C15H14O2S — CID 79965727
naphthalen-1-yl(1,4-oxathian-2-yl)methanone (PubChem CID 79965727) has the molecular formula C15H14O2S and a molecular weight of 258.34 g/mol. Its IUPAC name is naphthalen-1-yl(1,4-oxathian-2-yl)methanone.
| Compound Name | naphthalen-1-yl(1,4-oxathian-2-yl)methanone |
|---|---|
| PubChem CID | 79965727 |
| Molecular Formula | C15H14O2S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | naphthalen-1-yl(1,4-oxathian-2-yl)methanone |
| SMILES | O=C(c1cccc2ccccc12)C1CSCCO1 |
| InChI | InChI=1S/C15H14O2S/c16-15(14-10-18-9-8-17-14)13-7-3-5-11-4-1-2-6-12(11)13/h1-7,14H,8-10H2 |
| InChIKey | UQYOSBIZQFODFO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |