About N-[[2-(1,4-dithian-2-yl)-1H-imidazol-5-yl]methyl]propan-1-amine
N-[[2-(1,4-dithian-2-yl)-1H-imidazol-5-yl]methyl]propan-1-amine (PubChem CID 79965892) has the molecular formula C11H19N3S2
and a molecular weight of 257.43 g/mol. Its IUPAC name is N-[[2-(1,4-dithian-2-yl)-1H-imidazol-5-yl]methyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[[2-(1,4-dithian-2-yl)-1H-imidazol-5-yl]methyl]propan-1-amine |
| PubChem CID | 79965892 |
| Molecular Formula | C11H19N3S2 |
| Molecular Weight | 257.43 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | N-[[2-(1,4-dithian-2-yl)-1H-imidazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnc(C2CSCCS2)[nH]1 |
| InChI | InChI=1S/C11H19N3S2/c1-2-3-12-6-9-7-13-11(14-9)10-8-15-4-5-16-10/h7,10,12H,2-6,8H2,1H3,(H,13,14) |
| InChIKey | AABGDKLMEAHXFI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[[2-(1,4-dithian-2-yl)-1H-imidazol-5-yl]methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(1,4-dithian-2-yl)-1H-imidazol-5-yl]methyl]propan-1-amine?
The IUPAC name of N-[[2-(1,4-dithian-2-yl)-1H-imidazol-5-yl]methyl]propan-1-amine (CID 79965892) is N-[[2-(1,4-dithian-2-yl)-1H-imidazol-5-yl]methyl]propan-1-amine.
What is the SMILES notation for N-[[2-(1,4-dithian-2-yl)-1H-imidazol-5-yl]methyl]propan-1-amine?
The canonical SMILES for N-[[2-(1,4-dithian-2-yl)-1H-imidazol-5-yl]methyl]propan-1-amine is CCCNCc1cnc(C2CSCCS2)[nH]1.
What is the InChIKey of N-[[2-(1,4-dithian-2-yl)-1H-imidazol-5-yl]methyl]propan-1-amine?
The InChIKey is AABGDKLMEAHXFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3S2/c1-2-3-12-6-9-7-13-11(14-9)10-8-15-4-5-16-10/h7,10,12H,2-6,8H2,1H3,(H,13,14).
What are the key properties of N-[[2-(1,4-dithian-2-yl)-1H-imidazol-5-yl]methyl]propan-1-amine?
N-[[2-(1,4-dithian-2-yl)-1H-imidazol-5-yl]methyl]propan-1-amine has a molecular weight of 257.43 g/mol, XLogP of 2.43, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(1,4-dithian-2-yl)-1H-imidazol-5-yl]methyl]propan-1-amine is sourced from PubChem (CID 79965892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).