About 2-(1,4-dithian-2-yl)-1,3-thiazole-5-carbaldehyde
2-(1,4-dithian-2-yl)-1,3-thiazole-5-carbaldehyde (PubChem CID 79966744) has the molecular formula C8H9NOS3
and a molecular weight of 231.37 g/mol. Its IUPAC name is 2-(1,4-dithian-2-yl)-1,3-thiazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 2-(1,4-dithian-2-yl)-1,3-thiazole-5-carbaldehyde |
| PubChem CID | 79966744 |
| Molecular Formula | C8H9NOS3 |
| Molecular Weight | 231.37 g/mol |
| Exact Mass | 230.98 |
| IUPAC Name | 2-(1,4-dithian-2-yl)-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(C2CSCCS2)s1 |
| InChI | InChI=1S/C8H9NOS3/c10-4-6-3-9-8(13-6)7-5-11-1-2-12-7/h3-4,7H,1-2,5H2 |
| InChIKey | JTOHVDSKDLMLIK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,4-dithian-2-yl)-1,3-thiazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-dithian-2-yl)-1,3-thiazole-5-carbaldehyde?
The IUPAC name of 2-(1,4-dithian-2-yl)-1,3-thiazole-5-carbaldehyde (CID 79966744) is 2-(1,4-dithian-2-yl)-1,3-thiazole-5-carbaldehyde.
What is the SMILES notation for 2-(1,4-dithian-2-yl)-1,3-thiazole-5-carbaldehyde?
The canonical SMILES for 2-(1,4-dithian-2-yl)-1,3-thiazole-5-carbaldehyde is O=Cc1cnc(C2CSCCS2)s1.
What is the InChIKey of 2-(1,4-dithian-2-yl)-1,3-thiazole-5-carbaldehyde?
The InChIKey is JTOHVDSKDLMLIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NOS3/c10-4-6-3-9-8(13-6)7-5-11-1-2-12-7/h3-4,7H,1-2,5H2.
What are the key properties of 2-(1,4-dithian-2-yl)-1,3-thiazole-5-carbaldehyde?
2-(1,4-dithian-2-yl)-1,3-thiazole-5-carbaldehyde has a molecular weight of 231.37 g/mol, XLogP of 2.48, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-dithian-2-yl)-1,3-thiazole-5-carbaldehyde is sourced from PubChem (CID 79966744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).