C14H24N4O — CID 79967058
4-amino-9-propan-2-yl-1-prop-2-enyl-1,3,9-triazaspiro[4.6]undec-3-en-2-one (PubChem CID 79967058) has the molecular formula C14H24N4O and a molecular weight of 264.37 g/mol. Its IUPAC name is 4-amino-9-propan-2-yl-1-prop-2-enyl-1,3,9-triazaspiro[4.6]undec-3-en-2-one.
| Compound Name | 4-amino-9-propan-2-yl-1-prop-2-enyl-1,3,9-triazaspiro[4.6]undec-3-en-2-one |
|---|---|
| PubChem CID | 79967058 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 4-amino-9-propan-2-yl-1-prop-2-enyl-1,3,9-triazaspiro[4.6]undec-3-en-2-one |
| SMILES | C=CCN1C(=O)N=C(N)C12CCCN(C(C)C)CC2 |
| InChI | InChI=1S/C14H24N4O/c1-4-8-18-13(19)16-12(15)14(18)6-5-9-17(10-7-14)11(2)3/h4,11H,1,5-10H2,2-3H3,(H2,15,16,19) |
| InChIKey | JPRMNFATTKDCGF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|