C16H11ClNO2S- — CID 7996756
(2S)-4-(4-chlorophenyl)-2,3-dihydro-1,5-benzothiazepine-2-carboxylate (PubChem CID 7996756) has the molecular formula C16H11ClNO2S- and a molecular weight of 316.79 g/mol. Its IUPAC name is (2S)-4-(4-chlorophenyl)-2,3-dihydro-1,5-benzothiazepine-2-carboxylate.
| Compound Name | (2S)-4-(4-chlorophenyl)-2,3-dihydro-1,5-benzothiazepine-2-carboxylate |
|---|---|
| PubChem CID | 7996756 |
| Molecular Formula | C16H11ClNO2S- |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | (2S)-4-(4-chlorophenyl)-2,3-dihydro-1,5-benzothiazepine-2-carboxylate |
| SMILES | O=C([O-])[C@@H]1CC(c2ccc(Cl)cc2)=Nc2ccccc2S1 |
| InChI | InChI=1S/C16H12ClNO2S/c17-11-7-5-10(6-8-11)13-9-15(16(19)20)21-14-4-2-1-3-12(14)18-13/h1-8,15H,9H2,(H,19,20)/p-1/t15-/m0/s1 |
| InChIKey | KDHATOHQYYFMNE-HNNXBMFYSA-M |
| XLogP | 3.08 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |