C9H17N3O2 — CID 79968035
5-amino-3-(2-methoxyethyl)-4-propan-2-yl-4H-imidazol-2-one (PubChem CID 79968035) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 5-amino-3-(2-methoxyethyl)-4-propan-2-yl-4H-imidazol-2-one.
| Compound Name | 5-amino-3-(2-methoxyethyl)-4-propan-2-yl-4H-imidazol-2-one |
|---|---|
| PubChem CID | 79968035 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 5-amino-3-(2-methoxyethyl)-4-propan-2-yl-4H-imidazol-2-one |
| SMILES | COCCN1C(=O)N=C(N)C1C(C)C |
| InChI | InChI=1S/C9H17N3O2/c1-6(2)7-8(10)11-9(13)12(7)4-5-14-3/h6-7H,4-5H2,1-3H3,(H2,10,11,13) |
| InChIKey | YUUXXJAOTKFSLU-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |