About 4-amino-1-prop-2-enyl-5,5-dipropylimidazol-2-one
4-amino-1-prop-2-enyl-5,5-dipropylimidazol-2-one (PubChem CID 79968076) has the molecular formula C12H21N3O
and a molecular weight of 223.32 g/mol. Its IUPAC name is 4-amino-1-prop-2-enyl-5,5-dipropylimidazol-2-one.
Molecular Properties
| Compound Name | 4-amino-1-prop-2-enyl-5,5-dipropylimidazol-2-one |
| PubChem CID | 79968076 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 4-amino-1-prop-2-enyl-5,5-dipropylimidazol-2-one |
| SMILES | C=CCN1C(=O)N=C(N)C1(CCC)CCC |
| InChI | InChI=1S/C12H21N3O/c1-4-7-12(8-5-2)10(13)14-11(16)15(12)9-6-3/h6H,3-5,7-9H2,1-2H3,(H2,13,14,16) |
| InChIKey | AZVKYHLUSOMOQV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-1-prop-2-enyl-5,5-dipropylimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-prop-2-enyl-5,5-dipropylimidazol-2-one?
The IUPAC name of 4-amino-1-prop-2-enyl-5,5-dipropylimidazol-2-one (CID 79968076) is 4-amino-1-prop-2-enyl-5,5-dipropylimidazol-2-one.
What is the SMILES notation for 4-amino-1-prop-2-enyl-5,5-dipropylimidazol-2-one?
The canonical SMILES for 4-amino-1-prop-2-enyl-5,5-dipropylimidazol-2-one is C=CCN1C(=O)N=C(N)C1(CCC)CCC.
What is the InChIKey of 4-amino-1-prop-2-enyl-5,5-dipropylimidazol-2-one?
The InChIKey is AZVKYHLUSOMOQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O/c1-4-7-12(8-5-2)10(13)14-11(16)15(12)9-6-3/h6H,3-5,7-9H2,1-2H3,(H2,13,14,16).
What are the key properties of 4-amino-1-prop-2-enyl-5,5-dipropylimidazol-2-one?
4-amino-1-prop-2-enyl-5,5-dipropylimidazol-2-one has a molecular weight of 223.32 g/mol, XLogP of 2.30, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-prop-2-enyl-5,5-dipropylimidazol-2-one is sourced from PubChem (CID 79968076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).