About 4'-amino-1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one
4'-amino-1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one (PubChem CID 79968231) has the molecular formula C15H19N3O2
and a molecular weight of 273.34 g/mol. Its IUPAC name is 4'-amino-1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one.
Molecular Properties
| Compound Name | 4'-amino-1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one |
| PubChem CID | 79968231 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 4'-amino-1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one |
| SMILES | COCCN1C(=O)N=C(N)C12CCc1ccccc1C2 |
| InChI | InChI=1S/C15H19N3O2/c1-20-9-8-18-14(19)17-13(16)15(18)7-6-11-4-2-3-5-12(11)10-15/h2-5H,6-10H2,1H3,(H2,16,17,19) |
| InChIKey | LRJVPVCHYKDMAN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4'-amino-1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-amino-1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one?
The IUPAC name of 4'-amino-1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one (CID 79968231) is 4'-amino-1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one.
What is the SMILES notation for 4'-amino-1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one?
The canonical SMILES for 4'-amino-1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one is COCCN1C(=O)N=C(N)C12CCc1ccccc1C2.
What is the InChIKey of 4'-amino-1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one?
The InChIKey is LRJVPVCHYKDMAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O2/c1-20-9-8-18-14(19)17-13(16)15(18)7-6-11-4-2-3-5-12(11)10-15/h2-5H,6-10H2,1H3,(H2,16,17,19).
What are the key properties of 4'-amino-1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one?
4'-amino-1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one has a molecular weight of 273.34 g/mol, XLogP of 1.35, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-amino-1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one is sourced from PubChem (CID 79968231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).