C10H11N3OS — CID 79968261
5-amino-3-prop-2-enyl-4-thiophen-2-yl-4H-imidazol-2-one (PubChem CID 79968261) has the molecular formula C10H11N3OS and a molecular weight of 221.28 g/mol. Its IUPAC name is 5-amino-3-prop-2-enyl-4-thiophen-2-yl-4H-imidazol-2-one.
| Compound Name | 5-amino-3-prop-2-enyl-4-thiophen-2-yl-4H-imidazol-2-one |
|---|---|
| PubChem CID | 79968261 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 5-amino-3-prop-2-enyl-4-thiophen-2-yl-4H-imidazol-2-one |
| SMILES | C=CCN1C(=O)N=C(N)C1c1cccs1 |
| InChI | InChI=1S/C10H11N3OS/c1-2-5-13-8(7-4-3-6-15-7)9(11)12-10(13)14/h2-4,6,8H,1,5H2,(H2,11,12,14) |
| InChIKey | AIGKDXBMOOAQFY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|