About 4-(chloromethyl)-2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1,3-thiazole
4-(chloromethyl)-2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1,3-thiazole (PubChem CID 79969137) has the molecular formula C10H14ClN3S
and a molecular weight of 243.76 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 4-(chloromethyl)-2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1,3-thiazole |
| PubChem CID | 79969137 |
| Molecular Formula | C10H14ClN3S |
| Molecular Weight | 243.76 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 4-(chloromethyl)-2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1,3-thiazole |
| SMILES | ClCc1csc(C2CN3CCN2CC3)n1 |
| InChI | InChI=1S/C10H14ClN3S/c11-5-8-7-15-10(12-8)9-6-13-1-3-14(9)4-2-13/h7,9H,1-6H2 |
| InChIKey | IGGUGOPKXCRSMZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.76 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)-2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)-2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1,3-thiazole?
The IUPAC name of 4-(chloromethyl)-2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1,3-thiazole (CID 79969137) is 4-(chloromethyl)-2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1,3-thiazole.
What is the SMILES notation for 4-(chloromethyl)-2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1,3-thiazole?
The canonical SMILES for 4-(chloromethyl)-2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1,3-thiazole is ClCc1csc(C2CN3CCN2CC3)n1.
What is the InChIKey of 4-(chloromethyl)-2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1,3-thiazole?
The InChIKey is IGGUGOPKXCRSMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClN3S/c11-5-8-7-15-10(12-8)9-6-13-1-3-14(9)4-2-13/h7,9H,1-6H2.
What are the key properties of 4-(chloromethyl)-2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1,3-thiazole?
4-(chloromethyl)-2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1,3-thiazole has a molecular weight of 243.76 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)-2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1,3-thiazole is sourced from PubChem (CID 79969137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).