C12H20N2O — CID 79969165
1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-3-methylidenepentan-1-one (PubChem CID 79969165) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-3-methylidenepentan-1-one.
| Compound Name | 1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-3-methylidenepentan-1-one |
|---|---|
| PubChem CID | 79969165 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-(1,4-diazabicyclo[2.2.2]octan-2-yl)-3-methylidenepentan-1-one |
| SMILES | C=C(CC)CC(=O)C1CN2CCN1CC2 |
| InChI | InChI=1S/C12H20N2O/c1-3-10(2)8-12(15)11-9-13-4-6-14(11)7-5-13/h11H,2-9H2,1H3 |
| InChIKey | FUZOEEZNNBUHSH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|