C11H16N2OS — CID 79969742
1,4-diazabicyclo[2.2.2]octan-2-yl(thiophen-3-yl)methanol (PubChem CID 79969742) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is 1,4-diazabicyclo[2.2.2]octan-2-yl(thiophen-3-yl)methanol.
| Compound Name | 1,4-diazabicyclo[2.2.2]octan-2-yl(thiophen-3-yl)methanol |
|---|---|
| PubChem CID | 79969742 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1,4-diazabicyclo[2.2.2]octan-2-yl(thiophen-3-yl)methanol |
| SMILES | OC(c1ccsc1)C1CN2CCN1CC2 |
| InChI | InChI=1S/C11H16N2OS/c14-11(9-1-6-15-8-9)10-7-12-2-4-13(10)5-3-12/h1,6,8,10-11,14H,2-5,7H2 |
| InChIKey | GKQBOZBKULEGTL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |