C10H13N3O5 — CID 7996977
methyl 4-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]butanoate (PubChem CID 7996977) has the molecular formula C10H13N3O5 and a molecular weight of 255.23 g/mol. Its IUPAC name is methyl 4-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]butanoate.
| Compound Name | methyl 4-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]butanoate |
|---|---|
| PubChem CID | 7996977 |
| Molecular Formula | C10H13N3O5 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | methyl 4-[(2,4,6-trioxo-1,3-diazinan-5-yl)methylideneamino]butanoate |
| SMILES | COC(=O)CCC/N=C/C1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C10H13N3O5/c1-18-7(14)3-2-4-11-5-6-8(15)12-10(17)13-9(6)16/h5-6H,2-4H2,1H3,(H2,12,13,15,16,17)/b11-5+ |
| InChIKey | UNRJAUNQZGARQR-VZUCSPMQSA-N |
| XLogP | -1.01 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|