About [2-(1,4-oxathian-2-yl)pyrimidin-5-yl]methanamine
[2-(1,4-oxathian-2-yl)pyrimidin-5-yl]methanamine (PubChem CID 79970125) has the molecular formula C9H13N3OS
and a molecular weight of 211.29 g/mol. Its IUPAC name is [2-(1,4-oxathian-2-yl)pyrimidin-5-yl]methanamine.
Molecular Properties
| Compound Name | [2-(1,4-oxathian-2-yl)pyrimidin-5-yl]methanamine |
| PubChem CID | 79970125 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | [2-(1,4-oxathian-2-yl)pyrimidin-5-yl]methanamine |
| SMILES | NCc1cnc(C2CSCCO2)nc1 |
| InChI | InChI=1S/C9H13N3OS/c10-3-7-4-11-9(12-5-7)8-6-14-2-1-13-8/h4-5,8H,1-3,6,10H2 |
| InChIKey | XQOJOWCKWMCCLA-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(1,4-oxathian-2-yl)pyrimidin-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,4-oxathian-2-yl)pyrimidin-5-yl]methanamine?
The IUPAC name of [2-(1,4-oxathian-2-yl)pyrimidin-5-yl]methanamine (CID 79970125) is [2-(1,4-oxathian-2-yl)pyrimidin-5-yl]methanamine.
What is the SMILES notation for [2-(1,4-oxathian-2-yl)pyrimidin-5-yl]methanamine?
The canonical SMILES for [2-(1,4-oxathian-2-yl)pyrimidin-5-yl]methanamine is NCc1cnc(C2CSCCO2)nc1.
What is the InChIKey of [2-(1,4-oxathian-2-yl)pyrimidin-5-yl]methanamine?
The InChIKey is XQOJOWCKWMCCLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3OS/c10-3-7-4-11-9(12-5-7)8-6-14-2-1-13-8/h4-5,8H,1-3,6,10H2.
What are the key properties of [2-(1,4-oxathian-2-yl)pyrimidin-5-yl]methanamine?
[2-(1,4-oxathian-2-yl)pyrimidin-5-yl]methanamine has a molecular weight of 211.29 g/mol, XLogP of 0.74, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,4-oxathian-2-yl)pyrimidin-5-yl]methanamine is sourced from PubChem (CID 79970125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).