About 2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1H-pyrimidin-6-one
2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1H-pyrimidin-6-one (PubChem CID 79970436) has the molecular formula C10H14N4O
and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1H-pyrimidin-6-one |
| PubChem CID | 79970436 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1H-pyrimidin-6-one |
| SMILES | O=c1ccnc(C2CN3CCN2CC3)[nH]1 |
| InChI | InChI=1S/C10H14N4O/c15-9-1-2-11-10(12-9)8-7-13-3-5-14(8)6-4-13/h1-2,8H,3-7H2,(H,11,12,15) |
| InChIKey | LWLOHPVXAJZERR-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1H-pyrimidin-6-one?
The IUPAC name of 2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1H-pyrimidin-6-one (CID 79970436) is 2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1H-pyrimidin-6-one.
What is the SMILES notation for 2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1H-pyrimidin-6-one?
The canonical SMILES for 2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1H-pyrimidin-6-one is O=c1ccnc(C2CN3CCN2CC3)[nH]1.
What is the InChIKey of 2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1H-pyrimidin-6-one?
The InChIKey is LWLOHPVXAJZERR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O/c15-9-1-2-11-10(12-9)8-7-13-3-5-14(8)6-4-13/h1-2,8H,3-7H2,(H,11,12,15).
What are the key properties of 2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1H-pyrimidin-6-one?
2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1H-pyrimidin-6-one has a molecular weight of 206.25 g/mol, XLogP of -0.56, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-diazabicyclo[2.2.2]octan-2-yl)-1H-pyrimidin-6-one is sourced from PubChem (CID 79970436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).