C8H9BrN2O2S2 — CID 79970766
5-bromo-2-(1,4-dithian-2-yl)-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 79970766) has the molecular formula C8H9BrN2O2S2 and a molecular weight of 309.21 g/mol. Its IUPAC name is 5-bromo-2-(1,4-dithian-2-yl)-4-hydroxy-1H-pyrimidin-6-one.
| Compound Name | 5-bromo-2-(1,4-dithian-2-yl)-4-hydroxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 79970766 |
| Molecular Formula | C8H9BrN2O2S2 |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 307.93 |
| IUPAC Name | 5-bromo-2-(1,4-dithian-2-yl)-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(C2CSCCS2)nc(O)c1Br |
| InChI | InChI=1S/C8H9BrN2O2S2/c9-5-7(12)10-6(11-8(5)13)4-3-14-1-2-15-4/h4H,1-3H2,(H2,10,11,12,13) |
| InChIKey | STWGRBWZJJRQAA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |