C11H18N2OS2 — CID 79971179
1,4-dithian-2-yl-(1-propylpyrazol-4-yl)methanol (PubChem CID 79971179) has the molecular formula C11H18N2OS2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 1,4-dithian-2-yl-(1-propylpyrazol-4-yl)methanol.
| Compound Name | 1,4-dithian-2-yl-(1-propylpyrazol-4-yl)methanol |
|---|---|
| PubChem CID | 79971179 |
| Molecular Formula | C11H18N2OS2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 1,4-dithian-2-yl-(1-propylpyrazol-4-yl)methanol |
| SMILES | CCCn1cc(C(O)C2CSCCS2)cn1 |
| InChI | InChI=1S/C11H18N2OS2/c1-2-3-13-7-9(6-12-13)11(14)10-8-15-4-5-16-10/h6-7,10-11,14H,2-5,8H2,1H3 |
| InChIKey | GQLWPHMVJHEHLB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |