About 2-imidazol-1-ylethyl 4-phenylbenzoate
2-imidazol-1-ylethyl 4-phenylbenzoate (PubChem CID 7997127) has the molecular formula C18H16N2O2
and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-imidazol-1-ylethyl 4-phenylbenzoate.
Molecular Properties
| Compound Name | 2-imidazol-1-ylethyl 4-phenylbenzoate |
| PubChem CID | 7997127 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-imidazol-1-ylethyl 4-phenylbenzoate |
| SMILES | O=C(OCCn1ccnc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H16N2O2/c21-18(22-13-12-20-11-10-19-14-20)17-8-6-16(7-9-17)15-4-2-1-3-5-15/h1-11,14H,12-13H2 |
| InChIKey | FOIFRODTSWWLDM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-imidazol-1-ylethyl 4-phenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imidazol-1-ylethyl 4-phenylbenzoate?
The IUPAC name of 2-imidazol-1-ylethyl 4-phenylbenzoate (CID 7997127) is 2-imidazol-1-ylethyl 4-phenylbenzoate.
What is the SMILES notation for 2-imidazol-1-ylethyl 4-phenylbenzoate?
The canonical SMILES for 2-imidazol-1-ylethyl 4-phenylbenzoate is O=C(OCCn1ccnc1)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 2-imidazol-1-ylethyl 4-phenylbenzoate?
The InChIKey is FOIFRODTSWWLDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O2/c21-18(22-13-12-20-11-10-19-14-20)17-8-6-16(7-9-17)15-4-2-1-3-5-15/h1-11,14H,12-13H2.
What are the key properties of 2-imidazol-1-ylethyl 4-phenylbenzoate?
2-imidazol-1-ylethyl 4-phenylbenzoate has a molecular weight of 292.34 g/mol, XLogP of 3.41, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imidazol-1-ylethyl 4-phenylbenzoate is sourced from PubChem (CID 7997127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).