C13H16N2O3S2 — CID 79971472
6-[3-(1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 79971472) has the molecular formula C13H16N2O3S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is 6-[3-(1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[3-(1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 79971472 |
| Molecular Formula | C13H16N2O3S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 6-[3-(1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)C1CC=CCC1c1nc(C2CSCCS2)no1 |
| InChI | InChI=1S/C13H16N2O3S2/c16-13(17)9-4-2-1-3-8(9)12-14-11(15-18-12)10-7-19-5-6-20-10/h1-2,8-10H,3-7H2,(H,16,17) |
| InChIKey | UZQIYRDDRBCUQS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|