About (3,4-dimethylcyclohexyl)-(1,4-dithian-2-yl)methanol
(3,4-dimethylcyclohexyl)-(1,4-dithian-2-yl)methanol (PubChem CID 79971921) has the molecular formula C13H24OS2
and a molecular weight of 260.47 g/mol. Its IUPAC name is (3,4-dimethylcyclohexyl)-(1,4-dithian-2-yl)methanol.
Molecular Properties
| Compound Name | (3,4-dimethylcyclohexyl)-(1,4-dithian-2-yl)methanol |
| PubChem CID | 79971921 |
| Molecular Formula | C13H24OS2 |
| Molecular Weight | 260.47 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (3,4-dimethylcyclohexyl)-(1,4-dithian-2-yl)methanol |
| SMILES | CC1CCC(C(O)C2CSCCS2)CC1C |
| InChI | InChI=1S/C13H24OS2/c1-9-3-4-11(7-10(9)2)13(14)12-8-15-5-6-16-12/h9-14H,3-8H2,1-2H3 |
| InChIKey | HVQTXBPHFBKUKE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3,4-dimethylcyclohexyl)-(1,4-dithian-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dimethylcyclohexyl)-(1,4-dithian-2-yl)methanol?
The IUPAC name of (3,4-dimethylcyclohexyl)-(1,4-dithian-2-yl)methanol (CID 79971921) is (3,4-dimethylcyclohexyl)-(1,4-dithian-2-yl)methanol.
What is the SMILES notation for (3,4-dimethylcyclohexyl)-(1,4-dithian-2-yl)methanol?
The canonical SMILES for (3,4-dimethylcyclohexyl)-(1,4-dithian-2-yl)methanol is CC1CCC(C(O)C2CSCCS2)CC1C.
What is the InChIKey of (3,4-dimethylcyclohexyl)-(1,4-dithian-2-yl)methanol?
The InChIKey is HVQTXBPHFBKUKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24OS2/c1-9-3-4-11(7-10(9)2)13(14)12-8-15-5-6-16-12/h9-14H,3-8H2,1-2H3.
What are the key properties of (3,4-dimethylcyclohexyl)-(1,4-dithian-2-yl)methanol?
(3,4-dimethylcyclohexyl)-(1,4-dithian-2-yl)methanol has a molecular weight of 260.47 g/mol, XLogP of 3.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dimethylcyclohexyl)-(1,4-dithian-2-yl)methanol is sourced from PubChem (CID 79971921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).