About N-thieno[2,3-d]pyrimidin-4-ylmethanesulfonamide
N-thieno[2,3-d]pyrimidin-4-ylmethanesulfonamide (PubChem CID 7997212) has the molecular formula C7H7N3O2S2
and a molecular weight of 229.29 g/mol. Its IUPAC name is N-thieno[2,3-d]pyrimidin-4-ylmethanesulfonamide.
Molecular Properties
| Compound Name | N-thieno[2,3-d]pyrimidin-4-ylmethanesulfonamide |
| PubChem CID | 7997212 |
| Molecular Formula | C7H7N3O2S2 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.00 |
| IUPAC Name | N-thieno[2,3-d]pyrimidin-4-ylmethanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ncnc2sccc12 |
| InChI | InChI=1S/C7H7N3O2S2/c1-14(11,12)10-6-5-2-3-13-7(5)9-4-8-6/h2-4H,1H3,(H,8,9,10) |
| InChIKey | RFTYRLDKKDMLGC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-thieno[2,3-d]pyrimidin-4-ylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-thieno[2,3-d]pyrimidin-4-ylmethanesulfonamide?
The IUPAC name of N-thieno[2,3-d]pyrimidin-4-ylmethanesulfonamide (CID 7997212) is N-thieno[2,3-d]pyrimidin-4-ylmethanesulfonamide.
What is the SMILES notation for N-thieno[2,3-d]pyrimidin-4-ylmethanesulfonamide?
The canonical SMILES for N-thieno[2,3-d]pyrimidin-4-ylmethanesulfonamide is CS(=O)(=O)Nc1ncnc2sccc12.
What is the InChIKey of N-thieno[2,3-d]pyrimidin-4-ylmethanesulfonamide?
The InChIKey is RFTYRLDKKDMLGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2S2/c1-14(11,12)10-6-5-2-3-13-7(5)9-4-8-6/h2-4H,1H3,(H,8,9,10).
What are the key properties of N-thieno[2,3-d]pyrimidin-4-ylmethanesulfonamide?
N-thieno[2,3-d]pyrimidin-4-ylmethanesulfonamide has a molecular weight of 229.29 g/mol, XLogP of 1.06, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-thieno[2,3-d]pyrimidin-4-ylmethanesulfonamide is sourced from PubChem (CID 7997212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).