C17H22BrNOS — CID 79972309
N-[(5-bromo-2-ethoxyphenyl)-(3-ethylthiophen-2-yl)methyl]ethanamine (PubChem CID 79972309) has the molecular formula C17H22BrNOS and a molecular weight of 368.34 g/mol. Its IUPAC name is N-[(5-bromo-2-ethoxyphenyl)-(3-ethylthiophen-2-yl)methyl]ethanamine.
| Compound Name | N-[(5-bromo-2-ethoxyphenyl)-(3-ethylthiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 79972309 |
| Molecular Formula | C17H22BrNOS |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | N-[(5-bromo-2-ethoxyphenyl)-(3-ethylthiophen-2-yl)methyl]ethanamine |
| SMILES | CCNC(c1cc(Br)ccc1OCC)c1sccc1CC |
| InChI | InChI=1S/C17H22BrNOS/c1-4-12-9-10-21-17(12)16(19-5-2)14-11-13(18)7-8-15(14)20-6-3/h7-11,16,19H,4-6H2,1-3H3 |
| InChIKey | YJGCILPNSNXJLR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |