C11H14N2O2S — CID 79972352
2-(propylsulfinylmethyl)-1,3-benzoxazol-5-amine (PubChem CID 79972352) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is 2-(propylsulfinylmethyl)-1,3-benzoxazol-5-amine.
| Compound Name | 2-(propylsulfinylmethyl)-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 79972352 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-(propylsulfinylmethyl)-1,3-benzoxazol-5-amine |
| SMILES | CCCS(=O)Cc1nc2cc(N)ccc2o1 |
| InChI | InChI=1S/C11H14N2O2S/c1-2-5-16(14)7-11-13-9-6-8(12)3-4-10(9)15-11/h3-4,6H,2,5,7,12H2,1H3 |
| InChIKey | DEOWDHSDDWNJAA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|