C17H20N2S — CID 79972611
2-cyclopentyl-4-(4-cyclopropylphenyl)-1,3-thiazol-5-amine (PubChem CID 79972611) has the molecular formula C17H20N2S and a molecular weight of 284.43 g/mol. Its IUPAC name is 2-cyclopentyl-4-(4-cyclopropylphenyl)-1,3-thiazol-5-amine.
| Compound Name | 2-cyclopentyl-4-(4-cyclopropylphenyl)-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 79972611 |
| Molecular Formula | C17H20N2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-cyclopentyl-4-(4-cyclopropylphenyl)-1,3-thiazol-5-amine |
| SMILES | Nc1sc(C2CCCC2)nc1-c1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C17H20N2S/c18-16-15(19-17(20-16)14-3-1-2-4-14)13-9-7-12(8-10-13)11-5-6-11/h7-11,14H,1-6,18H2 |
| InChIKey | PHOXMXCUPCTMKT-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |