About 2-(1,4-dithian-2-yl)-5-ethyl-4-hydroxy-1H-pyrimidin-6-one
2-(1,4-dithian-2-yl)-5-ethyl-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 79972985) has the molecular formula C10H14N2O2S2
and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-(1,4-dithian-2-yl)-5-ethyl-4-hydroxy-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-(1,4-dithian-2-yl)-5-ethyl-4-hydroxy-1H-pyrimidin-6-one |
| PubChem CID | 79972985 |
| Molecular Formula | C10H14N2O2S2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 2-(1,4-dithian-2-yl)-5-ethyl-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | CCc1c(O)nc(C2CSCCS2)[nH]c1=O |
| InChI | InChI=1S/C10H14N2O2S2/c1-2-6-9(13)11-8(12-10(6)14)7-5-15-3-4-16-7/h7H,2-5H2,1H3,(H2,11,12,13,14) |
| InChIKey | PKUPTVVCLKLDRJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,4-dithian-2-yl)-5-ethyl-4-hydroxy-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-dithian-2-yl)-5-ethyl-4-hydroxy-1H-pyrimidin-6-one?
The IUPAC name of 2-(1,4-dithian-2-yl)-5-ethyl-4-hydroxy-1H-pyrimidin-6-one (CID 79972985) is 2-(1,4-dithian-2-yl)-5-ethyl-4-hydroxy-1H-pyrimidin-6-one.
What is the SMILES notation for 2-(1,4-dithian-2-yl)-5-ethyl-4-hydroxy-1H-pyrimidin-6-one?
The canonical SMILES for 2-(1,4-dithian-2-yl)-5-ethyl-4-hydroxy-1H-pyrimidin-6-one is CCc1c(O)nc(C2CSCCS2)[nH]c1=O.
What is the InChIKey of 2-(1,4-dithian-2-yl)-5-ethyl-4-hydroxy-1H-pyrimidin-6-one?
The InChIKey is PKUPTVVCLKLDRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2S2/c1-2-6-9(13)11-8(12-10(6)14)7-5-15-3-4-16-7/h7H,2-5H2,1H3,(H2,11,12,13,14).
What are the key properties of 2-(1,4-dithian-2-yl)-5-ethyl-4-hydroxy-1H-pyrimidin-6-one?
2-(1,4-dithian-2-yl)-5-ethyl-4-hydroxy-1H-pyrimidin-6-one has a molecular weight of 258.37 g/mol, XLogP of 1.56, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-dithian-2-yl)-5-ethyl-4-hydroxy-1H-pyrimidin-6-one is sourced from PubChem (CID 79972985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).